C17H23ClN4O3 — CID 163363069
tert-butyl N-[butan-2-yl-(4-chloro-1H-pyrrolo[2,3-b]pyridine-5-carbonyl)amino]carbamate (PubChem CID 163363069) has the molecular formula C17H23ClN4O3 and a molecular weight of 366.85 g/mol. Its IUPAC name is tert-butyl N-[butan-2-yl-(4-chloro-1H-pyrrolo[2,3-b]pyridine-5-carbonyl)amino]carbamate.
| Compound Name | tert-butyl N-[butan-2-yl-(4-chloro-1H-pyrrolo[2,3-b]pyridine-5-carbonyl)amino]carbamate |
|---|---|
| PubChem CID | 163363069 |
| Molecular Formula | C17H23ClN4O3 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | tert-butyl N-[butan-2-yl-(4-chloro-1H-pyrrolo[2,3-b]pyridine-5-carbonyl)amino]carbamate |
| SMILES | CCC(C)N(NC(=O)OC(C)(C)C)C(=O)c1cnc2[nH]ccc2c1Cl |
| InChI | InChI=1S/C17H23ClN4O3/c1-6-10(2)22(21-16(24)25-17(3,4)5)15(23)12-9-20-14-11(13(12)18)7-8-19-14/h7-10H,6H2,1-5H3,(H,19,20)(H,21,24) |
| InChIKey | WLWJMZLHAUKLNY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|