C38H46Cl2N4O6Si — CID 163363099
tert-butyl N-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-[4-chloro-3-(2-chloro-4-phenoxybenzoyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonyl]amino]carbamate (PubChem CID 163363099) has the molecular formula C38H46Cl2N4O6Si and a molecular weight of 753.80 g/mol. Its IUPAC name is tert-butyl N-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-[4-chloro-3-(2-chloro-4-phenoxybenzoyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonyl]amino]carbamate.
| Compound Name | tert-butyl N-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-[4-chloro-3-(2-chloro-4-phenoxybenzoyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 163363099 |
| Molecular Formula | C38H46Cl2N4O6Si |
| Molecular Weight | 753.80 g/mol |
| Exact Mass | 752.26 |
| IUPAC Name | tert-butyl N-[[4-[tert-butyl(dimethyl)silyl]oxycyclohexyl]-[4-chloro-3-(2-chloro-4-phenoxybenzoyl)-1H-pyrrolo[2,3-b]pyridine-5-carbonyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(C(=O)c1cnc2[nH]cc(C(=O)c3ccc(Oc4ccccc4)cc3Cl)c2c1Cl)C1CCC(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C38H46Cl2N4O6Si/c1-37(2,3)49-36(47)43-44(23-14-16-25(17-15-23)50-51(7,8)38(4,5)6)35(46)29-22-42-34-31(32(29)40)28(21-41-34)33(45)27-19-18-26(20-30(27)39)48-24-12-10-9-11-13-24/h9-13,18-23,25H,14-17H2,1-8H3,(H,41,42)(H,43,47) |
| InChIKey | YSVWLEAVRAJBCA-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 122.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.80 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|