C14H12ClN5S — CID 163367313
1-[2-(4-chlorophenyl)benzotriazol-5-yl]-3-methylthiourea (PubChem CID 163367313) has the molecular formula C14H12ClN5S and a molecular weight of 317.81 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)benzotriazol-5-yl]-3-methylthiourea.
| Compound Name | 1-[2-(4-chlorophenyl)benzotriazol-5-yl]-3-methylthiourea |
|---|---|
| PubChem CID | 163367313 |
| Molecular Formula | C14H12ClN5S |
| Molecular Weight | 317.81 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-[2-(4-chlorophenyl)benzotriazol-5-yl]-3-methylthiourea |
| SMILES | CNC(=S)Nc1ccc2nn(-c3ccc(Cl)cc3)nc2c1 |
| InChI | InChI=1S/C14H12ClN5S/c1-16-14(21)17-10-4-7-12-13(8-10)19-20(18-12)11-5-2-9(15)3-6-11/h2-8H,1H3,(H2,16,17,21) |
| InChIKey | XIFIPZVBKASDQB-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.81 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|