C16H20N4O3 — CID 163368021
2-imidazo[1,2-a]pyridin-3-ylbutan-2-ylcarbamoyl azetidine-1-carboxylate (PubChem CID 163368021) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-imidazo[1,2-a]pyridin-3-ylbutan-2-ylcarbamoyl azetidine-1-carboxylate.
| Compound Name | 2-imidazo[1,2-a]pyridin-3-ylbutan-2-ylcarbamoyl azetidine-1-carboxylate |
|---|---|
| PubChem CID | 163368021 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 2-imidazo[1,2-a]pyridin-3-ylbutan-2-ylcarbamoyl azetidine-1-carboxylate |
| SMILES | CCC(C)(NC(=O)OC(=O)N1CCC1)c1cnc2ccccn12 |
| InChI | InChI=1S/C16H20N4O3/c1-3-16(2,12-11-17-13-7-4-5-10-20(12)13)18-14(21)23-15(22)19-8-6-9-19/h4-5,7,10-11H,3,6,8-9H2,1-2H3,(H,18,21) |
| InChIKey | QBXKIWHDGLSMSQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|