C11H21NS — CID 163368473
(5Z)-4,4,7,7-tetramethyl-3,8-dihydro-2H-thiocin-2-amine (PubChem CID 163368473) has the molecular formula C11H21NS and a molecular weight of 199.36 g/mol. Its IUPAC name is (5Z)-4,4,7,7-tetramethyl-3,8-dihydro-2H-thiocin-2-amine.
| Compound Name | (5Z)-4,4,7,7-tetramethyl-3,8-dihydro-2H-thiocin-2-amine |
|---|---|
| PubChem CID | 163368473 |
| Molecular Formula | C11H21NS |
| Molecular Weight | 199.36 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (5Z)-4,4,7,7-tetramethyl-3,8-dihydro-2H-thiocin-2-amine |
| SMILES | CC1(C)/C=C\C(C)(C)CC(N)SC1 |
| InChI | InChI=1S/C11H21NS/c1-10(2)5-6-11(3,4)8-13-9(12)7-10/h5-6,9H,7-8,12H2,1-4H3/b6-5- |
| InChIKey | XIPAKQBLGPBZBT-WAYWQWQTSA-N |
| XLogP | 3.02 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|