C11H25N2+ — CID 163368726
(C,N-dimethylcarbonimidoyl)-methyl-prop-2-enylideneazanium;ethane (PubChem CID 163368726) has the molecular formula C11H25N2+ and a molecular weight of 185.33 g/mol. Its IUPAC name is (C,N-dimethylcarbonimidoyl)-methyl-prop-2-enylideneazanium;ethane.
| Compound Name | (C,N-dimethylcarbonimidoyl)-methyl-prop-2-enylideneazanium;ethane |
|---|---|
| PubChem CID | 163368726 |
| Molecular Formula | C11H25N2+ |
| Molecular Weight | 185.33 g/mol |
| Exact Mass | 185.20 |
| IUPAC Name | (C,N-dimethylcarbonimidoyl)-methyl-prop-2-enylideneazanium;ethane |
| SMILES | C=C/C=[N+](C)/C(C)=N/C.CC.CC |
| InChI | InChI=1S/C7H13N2.2C2H6/c1-5-6-9(4)7(2)8-3;2*1-2/h5-6H,1H2,2-4H3;2*1-2H3/q+1;;/b8-7+,9-6+;; |
| InChIKey | XYMFIUZEXSDDHL-JPMDGWNPSA-N |
| XLogP | 2.99 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|