C9H17N3 — CID 123155667
3-[(Z)-but-2-enylidene]-1-ethyl-1,2-dimethylguanidine (PubChem CID 123155667) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 3-[(Z)-but-2-enylidene]-1-ethyl-1,2-dimethylguanidine.
| Compound Name | 3-[(Z)-but-2-enylidene]-1-ethyl-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 123155667 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 3-[(Z)-but-2-enylidene]-1-ethyl-1,2-dimethylguanidine |
| SMILES | C/C=C\C=N/C(=N\C)N(C)CC |
| InChI | InChI=1S/C9H17N3/c1-5-7-8-11-9(10-3)12(4)6-2/h5,7-8H,6H2,1-4H3/b7-5-,10-9+,11-8? |
| InChIKey | FRHIWHMZVQEPOW-NKDWOPAZSA-N |
| XLogP | 1.57 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|