C10H17N3 — CID 178051809
ethane;1-ethenyl-N,6-dimethylpyrimidin-2-imine (PubChem CID 178051809) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is ethane;1-ethenyl-N,6-dimethylpyrimidin-2-imine.
| Compound Name | ethane;1-ethenyl-N,6-dimethylpyrimidin-2-imine |
|---|---|
| PubChem CID | 178051809 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | ethane;1-ethenyl-N,6-dimethylpyrimidin-2-imine |
| SMILES | C=Cn1c(C)ccn/c1=N\C.CC |
| InChI | InChI=1S/C8H11N3.C2H6/c1-4-11-7(2)5-6-10-8(11)9-3;1-2/h4-6H,1H2,2-3H3;1-2H3/b9-8+; |
| InChIKey | YOMZTWMZVSJNSI-HRNDJLQDSA-N |
| XLogP | 1.85 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |