C22H22F4N4 — CID 163368812
1-(3-fluorophenyl)-4-piperidin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]imidazol-2-amine (PubChem CID 163368812) has the molecular formula C22H22F4N4 and a molecular weight of 418.44 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-4-piperidin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]imidazol-2-amine.
| Compound Name | 1-(3-fluorophenyl)-4-piperidin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]imidazol-2-amine |
|---|---|
| PubChem CID | 163368812 |
| Molecular Formula | C22H22F4N4 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 1-(3-fluorophenyl)-4-piperidin-3-yl-N-[[4-(trifluoromethyl)phenyl]methyl]imidazol-2-amine |
| SMILES | Fc1cccc(-n2cc(C3CCCNC3)nc2NCc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C22H22F4N4/c23-18-4-1-5-19(11-18)30-14-20(16-3-2-10-27-13-16)29-21(30)28-12-15-6-8-17(9-7-15)22(24,25)26/h1,4-9,11,14,16,27H,2-3,10,12-13H2,(H,28,29) |
| InChIKey | VCXPYIWSFPKXTB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |