C18H18Cl2O2S — CID 163369029
2-(3-benzylsulfanyl-2,5-dichlorophenyl)propan-2-yl acetate (PubChem CID 163369029) has the molecular formula C18H18Cl2O2S and a molecular weight of 369.31 g/mol. Its IUPAC name is 2-(3-benzylsulfanyl-2,5-dichlorophenyl)propan-2-yl acetate.
| Compound Name | 2-(3-benzylsulfanyl-2,5-dichlorophenyl)propan-2-yl acetate |
|---|---|
| PubChem CID | 163369029 |
| Molecular Formula | C18H18Cl2O2S |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | 2-(3-benzylsulfanyl-2,5-dichlorophenyl)propan-2-yl acetate |
| SMILES | CC(=O)OC(C)(C)c1cc(Cl)cc(SCc2ccccc2)c1Cl |
| InChI | InChI=1S/C18H18Cl2O2S/c1-12(21)22-18(2,3)15-9-14(19)10-16(17(15)20)23-11-13-7-5-4-6-8-13/h4-10H,11H2,1-3H3 |
| InChIKey | LHTDDHOBCQTJBN-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |