C15H10F2N2 — CID 163369175
2,4-difluoro-5-isoquinolin-7-ylaniline (PubChem CID 163369175) has the molecular formula C15H10F2N2 and a molecular weight of 256.25 g/mol. Its IUPAC name is 2,4-difluoro-5-isoquinolin-7-ylaniline.
| Compound Name | 2,4-difluoro-5-isoquinolin-7-ylaniline |
|---|---|
| PubChem CID | 163369175 |
| Molecular Formula | C15H10F2N2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2,4-difluoro-5-isoquinolin-7-ylaniline |
| SMILES | Nc1cc(-c2ccc3ccncc3c2)c(F)cc1F |
| InChI | InChI=1S/C15H10F2N2/c16-13-7-14(17)15(18)6-12(13)10-2-1-9-3-4-19-8-11(9)5-10/h1-8H,18H2 |
| InChIKey | BHOJNJQFKFFKIO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|