C32H43B3N2O8 — CID 163369912
CID 163369912 (PubChem CID 163369912) has the molecular formula C32H43B3N2O8 and a molecular weight of 616.14 g/mol.
| Compound Name | CID 163369912 |
|---|---|
| PubChem CID | 163369912 |
| Molecular Formula | C32H43B3N2O8 |
| Molecular Weight | 616.14 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | — |
| SMILES | [B]c1cc(B(O)O)cc(C(=O)N(CC(=O)O)C2CCC(CC3CCC(NC(=O)c4cc(CCC)cc(B(O)O)c4)CC3)CC2)c1 |
| InChI | InChI=1S/C32H43B3N2O8/c1-2-3-22-13-23(16-26(14-22)34(42)43)31(40)36-28-8-4-20(5-9-28)12-21-6-10-29(11-7-21)37(19-30(38)39)32(41)24-15-25(33)18-27(17-24)35(44)45/h13-18,20-21,28-29,42-45H,2-12,19H2,1H3,(H,36,40)(H,38,39) |
| InChIKey | RYGXSMVKEPGWOQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 167.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.14 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|