C15H19BN2O2 — CID 89056342
CID 89056342 (PubChem CID 89056342) has the molecular formula C15H19BN2O2 and a molecular weight of 270.14 g/mol.
| Compound Name | CID 89056342 |
|---|---|
| PubChem CID | 89056342 |
| Molecular Formula | C15H19BN2O2 |
| Molecular Weight | 270.14 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(=O)NC2CC2)cc(C(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C15H19BN2O2/c1-3-18(4-2)15(20)11-7-10(8-12(16)9-11)14(19)17-13-5-6-13/h7-9,13H,3-6H2,1-2H3,(H,17,19) |
| InChIKey | MTVYGGLQFKJQEF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.14 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|