C24H26B2N3O7 — CID 163370085
CID 163370085 (PubChem CID 163370085) has the molecular formula C24H26B2N3O7 and a molecular weight of 490.11 g/mol.
| Compound Name | CID 163370085 |
|---|---|
| PubChem CID | 163370085 |
| Molecular Formula | C24H26B2N3O7 |
| Molecular Weight | 490.11 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | — |
| SMILES | CNCC=O.O=CC1CC(NC(=O)c2ccc3c(c2)[B]OC3)CN1C(=O)c1ccc2c(c1)B(O)OC2 |
| InChI | InChI=1S/C21H19B2N2O6.C3H7NO/c26-9-17-7-16(24-20(27)12-1-3-14-10-30-22-18(14)5-12)8-25(17)21(28)13-2-4-15-11-31-23(29)19(15)6-13;1-4-2-3-5/h1-6,9,16-17,29H,7-8,10-11H2,(H,24,27);3-4H,2H2,1H3 |
| InChIKey | XGOCWFGSALTQEU-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.11 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|