C17H15BF2N4O2 — CID 163371521
CID 163371521 (PubChem CID 163371521) has the molecular formula C17H15BF2N4O2 and a molecular weight of 356.14 g/mol.
| Compound Name | CID 163371521 |
|---|---|
| PubChem CID | 163371521 |
| Molecular Formula | C17H15BF2N4O2 |
| Molecular Weight | 356.14 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)C(C(C)F)CN(CC(=O)Nc1ncc(F)cn1)C2=O |
| InChI | InChI=1S/C17H15BF2N4O2/c1-9(19)14-7-24(16(26)12-3-2-10(18)4-13(12)14)8-15(25)23-17-21-5-11(20)6-22-17/h2-6,9,14H,7-8H2,1H3,(H,21,22,23,25) |
| InChIKey | VGPBUYLXRBISBU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.14 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|