C16H11BF4N4O2 — CID 166106307
CID 166106307 (PubChem CID 166106307) has the molecular formula C16H11BF4N4O2 and a molecular weight of 378.09 g/mol.
| Compound Name | CID 166106307 |
|---|---|
| PubChem CID | 166106307 |
| Molecular Formula | C16H11BF4N4O2 |
| Molecular Weight | 378.09 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)C(C(F)(F)F)CN(CC(=O)Nc1ncc(F)cn1)C2=O |
| InChI | InChI=1S/C16H11BF4N4O2/c17-8-1-2-10-11(3-8)12(16(19,20)21)6-25(14(10)27)7-13(26)24-15-22-4-9(18)5-23-15/h1-5,12H,6-7H2,(H,22,23,24,26) |
| InChIKey | CMMKDHCRFCSNQL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.09 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|