C13H13BFNO3 — CID 163371673
CID 163371673 (PubChem CID 163371673) has the molecular formula C13H13BFNO3 and a molecular weight of 261.06 g/mol.
| Compound Name | CID 163371673 |
|---|---|
| PubChem CID | 163371673 |
| Molecular Formula | C13H13BFNO3 |
| Molecular Weight | 261.06 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)N(CC(=O)O)CC2CC2F)cc1 |
| InChI | InChI=1S/C13H13BFNO3/c14-10-3-1-8(2-4-10)13(19)16(7-12(17)18)6-9-5-11(9)15/h1-4,9,11H,5-7H2,(H,17,18) |
| InChIKey | VJSLUDKKSXOBNV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.06 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|