About CID 163371673
CID 163371673 (PubChem CID 163371673) has the molecular formula C13H13BFNO3
and a molecular weight of 261.06 g/mol.
Molecular Properties
| Compound Name | CID 163371673 |
| PubChem CID | 163371673 |
| Molecular Formula | C13H13BFNO3 |
| Molecular Weight | 261.06 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(C(=O)N(CC(=O)O)CC2CC2F)cc1 |
| InChI | InChI=1S/C13H13BFNO3/c14-10-3-1-8(2-4-10)13(19)16(7-12(17)18)6-9-5-11(9)15/h1-4,9,11H,5-7H2,(H,17,18) |
| InChIKey | VJSLUDKKSXOBNV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.06 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 163371673 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163371673?
The IUPAC name of CID 163371673 (CID 163371673) is not available.
What is the SMILES notation for CID 163371673?
The canonical SMILES for CID 163371673 is [B]c1ccc(C(=O)N(CC(=O)O)CC2CC2F)cc1.
What is the InChIKey of CID 163371673?
The InChIKey is VJSLUDKKSXOBNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BFNO3/c14-10-3-1-8(2-4-10)13(19)16(7-12(17)18)6-9-5-11(9)15/h1-4,9,11H,5-7H2,(H,17,18).
What are the key properties of CID 163371673?
CID 163371673 has a molecular weight of 261.06 g/mol, XLogP of 0.37, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163371673 is sourced from PubChem (CID 163371673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).