C11H10F3N — CID 163372867
4,6,7-trifluoro-2-propan-2-yl-1H-indole (PubChem CID 163372867) has the molecular formula C11H10F3N and a molecular weight of 213.20 g/mol. Its IUPAC name is 4,6,7-trifluoro-2-propan-2-yl-1H-indole.
| Compound Name | 4,6,7-trifluoro-2-propan-2-yl-1H-indole |
|---|---|
| PubChem CID | 163372867 |
| Molecular Formula | C11H10F3N |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 4,6,7-trifluoro-2-propan-2-yl-1H-indole |
| SMILES | CC(C)c1cc2c(F)cc(F)c(F)c2[nH]1 |
| InChI | InChI=1S/C11H10F3N/c1-5(2)9-3-6-7(12)4-8(13)10(14)11(6)15-9/h3-5,15H,1-2H3 |
| InChIKey | WXPFMUGYEUBPBM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|