C27H36N7O3+ — CID 163374903
[amino-[6-[(Z)-C-[(1Z)-buta-1,3-dienyl]-N-methoxycarbonimidoyl]-4-(pyrrolidin-2-ylmethylamino)pyrrolo[1,2-b]pyridazin-3-yl]methylidene]-(2-ethyl-4-hydroxyphenyl)azanium;hydrate (PubChem CID 163374903) has the molecular formula C27H36N7O3+ and a molecular weight of 506.63 g/mol. Its IUPAC name is [amino-[6-[(Z)-C-[(1Z)-buta-1,3-dienyl]-N-methoxycarbonimidoyl]-4-(pyrrolidin-2-ylmethylamino)pyrrolo[1,2-b]pyridazin-3-yl]methylidene]-(2-ethyl-4-hydroxyphenyl)azanium;hydrate.
| Compound Name | [amino-[6-[(Z)-C-[(1Z)-buta-1,3-dienyl]-N-methoxycarbonimidoyl]-4-(pyrrolidin-2-ylmethylamino)pyrrolo[1,2-b]pyridazin-3-yl]methylidene]-(2-ethyl-4-hydroxyphenyl)azanium;hydrate |
|---|---|
| PubChem CID | 163374903 |
| Molecular Formula | C27H36N7O3+ |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | [amino-[6-[(Z)-C-[(1Z)-buta-1,3-dienyl]-N-methoxycarbonimidoyl]-4-(pyrrolidin-2-ylmethylamino)pyrrolo[1,2-b]pyridazin-3-yl]methylidene]-(2-ethyl-4-hydroxyphenyl)azanium;hydrate |
| SMILES | C=C/C=C\C(=N\OC)c1cc2c(NCC3CCCN3)c(/C(N)=[NH+]/c3ccc(O)cc3CC)cnn2c1.O |
| InChI | InChI=1S/C27H33N7O2.H2O/c1-4-6-9-24(33-36-3)19-14-25-26(30-15-20-8-7-12-29-20)22(16-31-34(25)17-19)27(28)32-23-11-10-21(35)13-18(23)5-2;/h4,6,9-11,13-14,16-17,20,29-30,35H,1,5,7-8,12,15H2,2-3H3,(H2,28,32);1H2/p+1/b9-6-,33-24-; |
| InChIKey | BDIQYZBVKIGZPV-WERDEJJTSA-O |
| XLogP | 1.15 |
| TPSA | 154.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|