C26H29N7O2 — CID 163375858
N'-(2-ethyl-4-hydroxyphenyl)-6-(1-oxidopyridin-1-ium-2-yl)-4-[[(2R)-pyrrolidin-2-yl]methylamino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375858) has the molecular formula C26H29N7O2 and a molecular weight of 471.57 g/mol. Its IUPAC name is N'-(2-ethyl-4-hydroxyphenyl)-6-(1-oxidopyridin-1-ium-2-yl)-4-[[(2R)-pyrrolidin-2-yl]methylamino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-(2-ethyl-4-hydroxyphenyl)-6-(1-oxidopyridin-1-ium-2-yl)-4-[[(2R)-pyrrolidin-2-yl]methylamino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375858 |
| Molecular Formula | C26H29N7O2 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | N'-(2-ethyl-4-hydroxyphenyl)-6-(1-oxidopyridin-1-ium-2-yl)-4-[[(2R)-pyrrolidin-2-yl]methylamino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O)ccc1/N=C(\N)c1cnn2cc(-c3cccc[n+]3[O-])cc2c1NC[C@H]1CCCN1 |
| InChI | InChI=1S/C26H29N7O2/c1-2-17-12-20(34)8-9-22(17)31-26(27)21-15-30-32-16-18(23-7-3-4-11-33(23)35)13-24(32)25(21)29-14-19-6-5-10-28-19/h3-4,7-9,11-13,15-16,19,28-29,34H,2,5-6,10,14H2,1H3,(H2,27,31)/t19-/m1/s1 |
| InChIKey | QFKVNBDOLWNQLT-LJQANCHMSA-N |
| XLogP | 3.10 |
| TPSA | 126.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|