C31H37FN6O — CID 163375813
4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-N'-(2-ethylphenyl)-6-(5-fluoro-4-hydroxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375813) has the molecular formula C31H37FN6O and a molecular weight of 528.68 g/mol. Its IUPAC name is 4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-N'-(2-ethylphenyl)-6-(5-fluoro-4-hydroxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-N'-(2-ethylphenyl)-6-(5-fluoro-4-hydroxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375813 |
| Molecular Formula | C31H37FN6O |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | 4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-N'-(2-ethylphenyl)-6-(5-fluoro-4-hydroxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1ccccc1/N=C(\N)c1cnn2cc(-c3cc(F)c(O)cc3C)cc2c1N[C@@H]1CC[C@](C)(N)C1(C)C |
| InChI | InChI=1S/C31H37FN6O/c1-6-19-9-7-8-10-24(19)36-29(33)22-16-35-38-17-20(21-15-23(32)26(39)13-18(21)2)14-25(38)28(22)37-27-11-12-31(5,34)30(27,3)4/h7-10,13-17,27,37,39H,6,11-12,34H2,1-5H3,(H2,33,36)/t27-,31+/m1/s1 |
| InChIKey | RHCALMHABKFUBP-JOMNFKBKSA-N |
| XLogP | 6.07 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|