C27H29N5O2 — CID 163375085
4-(cyclopentylamino)-N'-(2-ethyl-4-hydroxyphenyl)-6-(4-hydroxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375085) has the molecular formula C27H29N5O2 and a molecular weight of 455.56 g/mol. Its IUPAC name is 4-(cyclopentylamino)-N'-(2-ethyl-4-hydroxyphenyl)-6-(4-hydroxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 4-(cyclopentylamino)-N'-(2-ethyl-4-hydroxyphenyl)-6-(4-hydroxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375085 |
| Molecular Formula | C27H29N5O2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | 4-(cyclopentylamino)-N'-(2-ethyl-4-hydroxyphenyl)-6-(4-hydroxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O)ccc1/N=C(\N)c1cnn2cc(-c3ccc(O)cc3)cc2c1NC1CCCC1 |
| InChI | InChI=1S/C27H29N5O2/c1-2-17-13-22(34)11-12-24(17)31-27(28)23-15-29-32-16-19(18-7-9-21(33)10-8-18)14-25(32)26(23)30-20-5-3-4-6-20/h7-16,20,30,33-34H,2-6H2,1H3,(H2,28,31) |
| InChIKey | CQVJBZQDWVWIBO-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 108.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|