C27H30ClN7O4 — CID 175739631
4-[(4-aminocyclohexyl)amino]-N'-(2-chloro-4-hydroxyphenyl)-6-(6-methoxy-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide;formic acid (PubChem CID 175739631) has the molecular formula C27H30ClN7O4 and a molecular weight of 552.04 g/mol. Its IUPAC name is 4-[(4-aminocyclohexyl)amino]-N'-(2-chloro-4-hydroxyphenyl)-6-(6-methoxy-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide;formic acid.
| Compound Name | 4-[(4-aminocyclohexyl)amino]-N'-(2-chloro-4-hydroxyphenyl)-6-(6-methoxy-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide;formic acid |
|---|---|
| PubChem CID | 175739631 |
| Molecular Formula | C27H30ClN7O4 |
| Molecular Weight | 552.04 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | 4-[(4-aminocyclohexyl)amino]-N'-(2-chloro-4-hydroxyphenyl)-6-(6-methoxy-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide;formic acid |
| SMILES | COc1ccc(-c2cc3c(NC4CCC(N)CC4)c(/C(N)=N/c4ccc(O)cc4Cl)cnn3c2)cn1.O=CO |
| InChI | InChI=1S/C26H28ClN7O2.CH2O2/c1-36-24-9-2-15(12-30-24)16-10-23-25(32-18-5-3-17(28)4-6-18)20(13-31-34(23)14-16)26(29)33-22-8-7-19(35)11-21(22)27;2-1-3/h2,7-14,17-18,32,35H,3-6,28H2,1H3,(H2,29,33);1H,(H,2,3) |
| InChIKey | DDPCLPQVYITUNP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 173.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.04 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|