C29H30ClFN6O2 — CID 163374934
methyl 4-[4-[(4-aminocyclohexyl)amino]-3-[N'-(2-chloro-5-fluorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-6-yl]-3-methylbenzoate (PubChem CID 163374934) has the molecular formula C29H30ClFN6O2 and a molecular weight of 549.05 g/mol. Its IUPAC name is methyl 4-[4-[(4-aminocyclohexyl)amino]-3-[N'-(2-chloro-5-fluorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-6-yl]-3-methylbenzoate.
| Compound Name | methyl 4-[4-[(4-aminocyclohexyl)amino]-3-[N'-(2-chloro-5-fluorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-6-yl]-3-methylbenzoate |
|---|---|
| PubChem CID | 163374934 |
| Molecular Formula | C29H30ClFN6O2 |
| Molecular Weight | 549.05 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | methyl 4-[4-[(4-aminocyclohexyl)amino]-3-[N'-(2-chloro-5-fluorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-6-yl]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(-c2cc3c(NC4CCC(N)CC4)c(/C(N)=N/c4cc(F)ccc4Cl)cnn3c2)c(C)c1 |
| InChI | InChI=1S/C29H30ClFN6O2/c1-16-11-17(29(38)39-2)3-9-22(16)18-12-26-27(35-21-7-5-20(32)6-8-21)23(14-34-37(26)15-18)28(33)36-25-13-19(31)4-10-24(25)30/h3-4,9-15,20-21,35H,5-8,32H2,1-2H3,(H2,33,36) |
| InChIKey | PWQIXTZPQHZAKR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.05 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|