C33H39ClFN7O5 — CID 163375199
5-[3-[N'-(2-chloro-5-fluorophenyl)carbamimidoyl]-4-(cyclohexylamino)pyrrolo[1,2-b]pyridazin-6-yl]-N-[2-(2-methoxyethoxy)ethyl]-4-methylpyridine-2-carboxamide;formic acid (PubChem CID 163375199) has the molecular formula C33H39ClFN7O5 and a molecular weight of 668.17 g/mol. Its IUPAC name is 5-[3-[N'-(2-chloro-5-fluorophenyl)carbamimidoyl]-4-(cyclohexylamino)pyrrolo[1,2-b]pyridazin-6-yl]-N-[2-(2-methoxyethoxy)ethyl]-4-methylpyridine-2-carboxamide;formic acid.
| Compound Name | 5-[3-[N'-(2-chloro-5-fluorophenyl)carbamimidoyl]-4-(cyclohexylamino)pyrrolo[1,2-b]pyridazin-6-yl]-N-[2-(2-methoxyethoxy)ethyl]-4-methylpyridine-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 163375199 |
| Molecular Formula | C33H39ClFN7O5 |
| Molecular Weight | 668.17 g/mol |
| Exact Mass | 667.27 |
| IUPAC Name | 5-[3-[N'-(2-chloro-5-fluorophenyl)carbamimidoyl]-4-(cyclohexylamino)pyrrolo[1,2-b]pyridazin-6-yl]-N-[2-(2-methoxyethoxy)ethyl]-4-methylpyridine-2-carboxamide;formic acid |
| SMILES | COCCOCCNC(=O)c1cc(C)c(-c2cc3c(NC4CCCCC4)c(/C(N)=N/c4cc(F)ccc4Cl)cnn3c2)cn1.O=CO |
| InChI | InChI=1S/C32H37ClFN7O3.CH2O2/c1-20-14-28(32(42)36-10-11-44-13-12-43-2)37-17-24(20)21-15-29-30(39-23-6-4-3-5-7-23)25(18-38-41(29)19-21)31(35)40-27-16-22(34)8-9-26(27)33;2-1-3/h8-9,14-19,23,39H,3-7,10-13H2,1-2H3,(H2,35,40)(H,36,42);1H,(H,2,3) |
| InChIKey | CEDAWFLMAAQJLK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 165.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.17 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|