C29H33FN6O — CID 163375186
4-[(3-aminocyclopentyl)amino]-N'-(2-ethyl-5-fluorophenyl)-6-(4-methoxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375186) has the molecular formula C29H33FN6O and a molecular weight of 500.62 g/mol. Its IUPAC name is 4-[(3-aminocyclopentyl)amino]-N'-(2-ethyl-5-fluorophenyl)-6-(4-methoxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 4-[(3-aminocyclopentyl)amino]-N'-(2-ethyl-5-fluorophenyl)-6-(4-methoxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375186 |
| Molecular Formula | C29H33FN6O |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.27 |
| IUPAC Name | 4-[(3-aminocyclopentyl)amino]-N'-(2-ethyl-5-fluorophenyl)-6-(4-methoxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1ccc(F)cc1/N=C(\N)c1cnn2cc(-c3ccc(OC)cc3C)cc2c1NC1CCC(N)C1 |
| InChI | InChI=1S/C29H33FN6O/c1-4-18-5-6-20(30)13-26(18)35-29(32)25-15-33-36-16-19(24-10-9-23(37-3)11-17(24)2)12-27(36)28(25)34-22-8-7-21(31)14-22/h5-6,9-13,15-16,21-22,34H,4,7-8,14,31H2,1-3H3,(H2,32,35) |
| InChIKey | LSTUZWMKLAMLHK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|