C33H41ClN6O — CID 163375707
N'-(2-chlorophenyl)-4-[[(1R,3S)-3-(dipropylamino)cyclopentyl]amino]-6-(4-methoxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375707) has the molecular formula C33H41ClN6O and a molecular weight of 573.19 g/mol. Its IUPAC name is N'-(2-chlorophenyl)-4-[[(1R,3S)-3-(dipropylamino)cyclopentyl]amino]-6-(4-methoxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-(2-chlorophenyl)-4-[[(1R,3S)-3-(dipropylamino)cyclopentyl]amino]-6-(4-methoxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375707 |
| Molecular Formula | C33H41ClN6O |
| Molecular Weight | 573.19 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | N'-(2-chlorophenyl)-4-[[(1R,3S)-3-(dipropylamino)cyclopentyl]amino]-6-(4-methoxy-2-methylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCCN(CCC)[C@H]1CC[C@@H](Nc2c(/C(N)=N/c3ccccc3Cl)cnn3cc(-c4ccc(OC)cc4C)cc23)C1 |
| InChI | InChI=1S/C33H41ClN6O/c1-5-15-39(16-6-2)25-12-11-24(19-25)37-32-28(33(35)38-30-10-8-7-9-29(30)34)20-36-40-21-23(18-31(32)40)27-14-13-26(41-4)17-22(27)3/h7-10,13-14,17-18,20-21,24-25,37H,5-6,11-12,15-16,19H2,1-4H3,(H2,35,38)/t24-,25+/m1/s1 |
| InChIKey | BLPSXPYLHCMHBI-RPBOFIJWSA-N |
| XLogP | 7.46 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.19 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|