C30H36ClFN8O2 — CID 163374906
4-[(3-aminocyclopentyl)amino]-N'-(2-chloro-5-fluorophenyl)-6-[4-(2-methoxyethylamino)-2-methylphenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide;formamide (PubChem CID 163374906) has the molecular formula C30H36ClFN8O2 and a molecular weight of 595.12 g/mol. Its IUPAC name is 4-[(3-aminocyclopentyl)amino]-N'-(2-chloro-5-fluorophenyl)-6-[4-(2-methoxyethylamino)-2-methylphenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide;formamide.
| Compound Name | 4-[(3-aminocyclopentyl)amino]-N'-(2-chloro-5-fluorophenyl)-6-[4-(2-methoxyethylamino)-2-methylphenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide;formamide |
|---|---|
| PubChem CID | 163374906 |
| Molecular Formula | C30H36ClFN8O2 |
| Molecular Weight | 595.12 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | 4-[(3-aminocyclopentyl)amino]-N'-(2-chloro-5-fluorophenyl)-6-[4-(2-methoxyethylamino)-2-methylphenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide;formamide |
| SMILES | COCCNc1ccc(-c2cc3c(NC4CCC(N)C4)c(/C(N)=N/c4cc(F)ccc4Cl)cnn3c2)c(C)c1.NC=O |
| InChI | InChI=1S/C29H33ClFN7O.CH3NO/c1-17-11-21(34-9-10-39-2)6-7-23(17)18-12-27-28(36-22-5-4-20(32)14-22)24(15-35-38(27)16-18)29(33)37-26-13-19(31)3-8-25(26)30;2-1-3/h3,6-8,11-13,15-16,20,22,34,36H,4-5,9-10,14,32H2,1-2H3,(H2,33,37);1H,(H2,2,3) |
| InChIKey | AVIQYUSIILAABO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.12 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|