C27H29ClN6O2S — CID 167079583
4-[[(1R,3S)-3-aminocyclopentyl]amino]-N'-(2-chlorophenyl)-6-(2-methyl-4-methylsulfonylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 167079583) has the molecular formula C27H29ClN6O2S and a molecular weight of 537.09 g/mol. Its IUPAC name is 4-[[(1R,3S)-3-aminocyclopentyl]amino]-N'-(2-chlorophenyl)-6-(2-methyl-4-methylsulfonylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 4-[[(1R,3S)-3-aminocyclopentyl]amino]-N'-(2-chlorophenyl)-6-(2-methyl-4-methylsulfonylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 167079583 |
| Molecular Formula | C27H29ClN6O2S |
| Molecular Weight | 537.09 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | 4-[[(1R,3S)-3-aminocyclopentyl]amino]-N'-(2-chlorophenyl)-6-(2-methyl-4-methylsulfonylphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | Cc1cc(S(C)(=O)=O)ccc1-c1cc2c(N[C@@H]3CC[C@H](N)C3)c(/C(N)=N/c3ccccc3Cl)cnn2c1 |
| InChI | InChI=1S/C27H29ClN6O2S/c1-16-11-20(37(2,35)36)9-10-21(16)17-12-25-26(32-19-8-7-18(29)13-19)22(14-31-34(25)15-17)27(30)33-24-6-4-3-5-23(24)28/h3-6,9-12,14-15,18-19,32H,7-8,13,29H2,1-2H3,(H2,30,33)/t18-,19+/m0/s1 |
| InChIKey | QLTQNKZRNYWUSE-RBUKOAKNSA-N |
| XLogP | 4.70 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.09 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|