C25H28ClN7 — CID 163375745
N'-(2-chlorophenyl)-4-(methylamino)-6-(4-methyl-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide;pyrrolidine (PubChem CID 163375745) has the molecular formula C25H28ClN7 and a molecular weight of 462.00 g/mol. Its IUPAC name is N'-(2-chlorophenyl)-4-(methylamino)-6-(4-methyl-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide;pyrrolidine.
| Compound Name | N'-(2-chlorophenyl)-4-(methylamino)-6-(4-methyl-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide;pyrrolidine |
|---|---|
| PubChem CID | 163375745 |
| Molecular Formula | C25H28ClN7 |
| Molecular Weight | 462.00 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N'-(2-chlorophenyl)-4-(methylamino)-6-(4-methyl-3-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide;pyrrolidine |
| SMILES | C1CCNC1.CNc1c(/C(N)=N/c2ccccc2Cl)cnn2cc(-c3cnccc3C)cc12 |
| InChI | InChI=1S/C21H19ClN6.C4H9N/c1-13-7-8-25-10-15(13)14-9-19-20(24-2)16(11-26-28(19)12-14)21(23)27-18-6-4-3-5-17(18)22;1-2-4-5-3-1/h3-12,24H,1-2H3,(H2,23,27);5H,1-4H2 |
| InChIKey | KJTKGBLQNXFXNH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.00 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|