C27H28ClFN6 — CID 163375494
N'-(2-chloro-5-fluorophenyl)-4-(cyclohexylamino)-6-(3-ethyl-4-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375494) has the molecular formula C27H28ClFN6 and a molecular weight of 491.01 g/mol. Its IUPAC name is N'-(2-chloro-5-fluorophenyl)-4-(cyclohexylamino)-6-(3-ethyl-4-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-(2-chloro-5-fluorophenyl)-4-(cyclohexylamino)-6-(3-ethyl-4-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375494 |
| Molecular Formula | C27H28ClFN6 |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | N'-(2-chloro-5-fluorophenyl)-4-(cyclohexylamino)-6-(3-ethyl-4-pyridinyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cnccc1-c1cc2c(NC3CCCCC3)c(/C(N)=N/c3cc(F)ccc3Cl)cnn2c1 |
| InChI | InChI=1S/C27H28ClFN6/c1-2-17-14-31-11-10-21(17)18-12-25-26(33-20-6-4-3-5-7-20)22(15-32-35(25)16-18)27(30)34-24-13-19(29)8-9-23(24)28/h8-16,20,33H,2-7H2,1H3,(H2,30,34) |
| InChIKey | QVZZTLZUHOEPMB-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|