C21H24Cl2N6 — CID 163375896
4-[(4-aminocyclohexyl)amino]-N'-(2,6-dichlorophenyl)-6-methylpyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375896) has the molecular formula C21H24Cl2N6 and a molecular weight of 431.37 g/mol. Its IUPAC name is 4-[(4-aminocyclohexyl)amino]-N'-(2,6-dichlorophenyl)-6-methylpyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 4-[(4-aminocyclohexyl)amino]-N'-(2,6-dichlorophenyl)-6-methylpyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375896 |
| Molecular Formula | C21H24Cl2N6 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 4-[(4-aminocyclohexyl)amino]-N'-(2,6-dichlorophenyl)-6-methylpyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | Cc1cc2c(NC3CCC(N)CC3)c(/C(N)=N/c3c(Cl)cccc3Cl)cnn2c1 |
| InChI | InChI=1S/C21H24Cl2N6/c1-12-9-18-19(27-14-7-5-13(24)6-8-14)15(10-26-29(18)11-12)21(25)28-20-16(22)3-2-4-17(20)23/h2-4,9-11,13-14,27H,5-8,24H2,1H3,(H2,25,28) |
| InChIKey | SCPPFOXNBDOXPL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|