C25H29BrCl2N6O2 — CID 163375860
tert-butyl N-[4-[[6-bromo-3-[N'-(2,6-dichlorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-4-yl]amino]cyclohexyl]carbamate (PubChem CID 163375860) has the molecular formula C25H29BrCl2N6O2 and a molecular weight of 596.36 g/mol. Its IUPAC name is tert-butyl N-[4-[[6-bromo-3-[N'-(2,6-dichlorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-4-yl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[6-bromo-3-[N'-(2,6-dichlorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-4-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 163375860 |
| Molecular Formula | C25H29BrCl2N6O2 |
| Molecular Weight | 596.36 g/mol |
| Exact Mass | 594.09 |
| IUPAC Name | tert-butyl N-[4-[[6-bromo-3-[N'-(2,6-dichlorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-4-yl]amino]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCC(Nc2c(/C(N)=N/c3c(Cl)cccc3Cl)cnn3cc(Br)cc23)CC1 |
| InChI | InChI=1S/C25H29BrCl2N6O2/c1-25(2,3)36-24(35)32-16-9-7-15(8-10-16)31-21-17(12-30-34-13-14(26)11-20(21)34)23(29)33-22-18(27)5-4-6-19(22)28/h4-6,11-13,15-16,31H,7-10H2,1-3H3,(H2,29,33)(H,32,35) |
| InChIKey | LMLRIOITTMCNFD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.36 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|