C26H34BrN5O3Si — CID 172730150
6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-4-[[(3S)-5-oxooxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 172730150) has the molecular formula C26H34BrN5O3Si and a molecular weight of 572.58 g/mol. Its IUPAC name is 6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-4-[[(3S)-5-oxooxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-4-[[(3S)-5-oxooxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 172730150 |
| Molecular Formula | C26H34BrN5O3Si |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | 6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-4-[[(3S)-5-oxooxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O[Si](C)(C)C(C)(C)C)ccc1/N=C(\N)c1cnn2cc(Br)cc2c1N[C@@H]1COC(=O)C1 |
| InChI | InChI=1S/C26H34BrN5O3Si/c1-7-16-10-19(35-36(5,6)26(2,3)4)8-9-21(16)31-25(28)20-13-29-32-14-17(27)11-22(32)24(20)30-18-12-23(33)34-15-18/h8-11,13-14,18,30H,7,12,15H2,1-6H3,(H2,28,31)/t18-/m0/s1 |
| InChIKey | HRKRUDOINQIBPV-SFHVURJKSA-N |
| XLogP | 5.81 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|