C22H20ClN7O3 — CID 163376023
N'-(2-chloro-4-hydroxyphenyl)-6-(1-methylpyrazol-4-yl)-4-[(5-oxooxolan-3-yl)amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163376023) has the molecular formula C22H20ClN7O3 and a molecular weight of 465.90 g/mol. Its IUPAC name is N'-(2-chloro-4-hydroxyphenyl)-6-(1-methylpyrazol-4-yl)-4-[(5-oxooxolan-3-yl)amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-(2-chloro-4-hydroxyphenyl)-6-(1-methylpyrazol-4-yl)-4-[(5-oxooxolan-3-yl)amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163376023 |
| Molecular Formula | C22H20ClN7O3 |
| Molecular Weight | 465.90 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | N'-(2-chloro-4-hydroxyphenyl)-6-(1-methylpyrazol-4-yl)-4-[(5-oxooxolan-3-yl)amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | Cn1cc(-c2cc3c(NC4COC(=O)C4)c(/C(N)=N/c4ccc(O)cc4Cl)cnn3c2)cn1 |
| InChI | InChI=1S/C22H20ClN7O3/c1-29-9-13(7-25-29)12-4-19-21(27-14-5-20(32)33-11-14)16(8-26-30(19)10-12)22(24)28-18-3-2-15(31)6-17(18)23/h2-4,6-10,14,27,31H,5,11H2,1H3,(H2,24,28) |
| InChIKey | KBNKNMJJMYIDKV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.90 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|