C27H30N6O3 — CID 163375082
N'-(2-ethyl-4-hydroxyphenyl)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375082) has the molecular formula C27H30N6O3 and a molecular weight of 486.58 g/mol. Its IUPAC name is N'-(2-ethyl-4-hydroxyphenyl)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-(2-ethyl-4-hydroxyphenyl)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375082 |
| Molecular Formula | C27H30N6O3 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | N'-(2-ethyl-4-hydroxyphenyl)-6-(2-methoxy-6-methyl-3-pyridinyl)-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O)ccc1/N=C(\N)c1cnn2cc(-c3ccc(C)nc3OC)cc2c1N[C@H]1CCOC1 |
| InChI | InChI=1S/C27H30N6O3/c1-4-17-11-20(34)6-8-23(17)32-26(28)22-13-29-33-14-18(21-7-5-16(2)30-27(21)35-3)12-24(33)25(22)31-19-9-10-36-15-19/h5-8,11-14,19,31,34H,4,9-10,15H2,1-3H3,(H2,28,32)/t19-/m0/s1 |
| InChIKey | WSGMOSDDLZYIMT-IBGZPJMESA-N |
| XLogP | 4.22 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|