C30H33N9O3 — CID 163375893
1-(2-cyanoethyl)-3-[5-[3-[N'-(2-ethyl-4-hydroxyphenyl)carbamimidoyl]-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazin-6-yl]-4-methyl-2-pyridinyl]urea (PubChem CID 163375893) has the molecular formula C30H33N9O3 and a molecular weight of 567.65 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-3-[5-[3-[N'-(2-ethyl-4-hydroxyphenyl)carbamimidoyl]-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazin-6-yl]-4-methyl-2-pyridinyl]urea.
| Compound Name | 1-(2-cyanoethyl)-3-[5-[3-[N'-(2-ethyl-4-hydroxyphenyl)carbamimidoyl]-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazin-6-yl]-4-methyl-2-pyridinyl]urea |
|---|---|
| PubChem CID | 163375893 |
| Molecular Formula | C30H33N9O3 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | 1-(2-cyanoethyl)-3-[5-[3-[N'-(2-ethyl-4-hydroxyphenyl)carbamimidoyl]-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazin-6-yl]-4-methyl-2-pyridinyl]urea |
| SMILES | CCc1cc(O)ccc1/N=C(\N)c1cnn2cc(-c3cnc(NC(=O)NCCC#N)cc3C)cc2c1N[C@H]1CCOC1 |
| InChI | InChI=1S/C30H33N9O3/c1-3-19-12-22(40)5-6-25(19)37-29(32)24-15-35-39-16-20(13-26(39)28(24)36-21-7-10-42-17-21)23-14-34-27(11-18(23)2)38-30(41)33-9-4-8-31/h5-6,11-16,21,36,40H,3-4,7,9-10,17H2,1-2H3,(H2,32,37)(H2,33,34,38,41)/t21-/m0/s1 |
| InChIKey | FXQPXDCGZKHKRN-NRFANRHFSA-N |
| XLogP | 4.25 |
| TPSA | 174.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|