C31H39N7O2 — CID 163375432
6-[3-amino-5-(hydroxymethyl)phenyl]-4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-N'-(2-ethyl-4-hydroxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375432) has the molecular formula C31H39N7O2 and a molecular weight of 541.70 g/mol. Its IUPAC name is 6-[3-amino-5-(hydroxymethyl)phenyl]-4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-N'-(2-ethyl-4-hydroxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 6-[3-amino-5-(hydroxymethyl)phenyl]-4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-N'-(2-ethyl-4-hydroxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375432 |
| Molecular Formula | C31H39N7O2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | 6-[3-amino-5-(hydroxymethyl)phenyl]-4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-N'-(2-ethyl-4-hydroxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O)ccc1/N=C(\N)c1cnn2cc(-c3cc(N)cc(CO)c3)cc2c1N[C@@H]1CC[C@](C)(N)C1(C)C |
| InChI | InChI=1S/C31H39N7O2/c1-5-19-13-23(40)6-7-25(19)36-29(33)24-15-35-38-16-21(20-10-18(17-39)11-22(32)12-20)14-26(38)28(24)37-27-8-9-31(4,34)30(27,2)3/h6-7,10-16,27,37,39-40H,5,8-9,17,32,34H2,1-4H3,(H2,33,36)/t27-,31+/m1/s1 |
| InChIKey | HBEKNPXAWQAGEG-JOMNFKBKSA-N |
| XLogP | 4.70 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|