C30H37N7O2 — CID 167079388
4-[(3-amino-2,2-dimethylcyclopentyl)amino]-6-[3-amino-5-(hydroxymethyl)phenyl]-N'-(2-ethyl-4-hydroxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 167079388) has the molecular formula C30H37N7O2 and a molecular weight of 527.67 g/mol. Its IUPAC name is 4-[(3-amino-2,2-dimethylcyclopentyl)amino]-6-[3-amino-5-(hydroxymethyl)phenyl]-N'-(2-ethyl-4-hydroxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 4-[(3-amino-2,2-dimethylcyclopentyl)amino]-6-[3-amino-5-(hydroxymethyl)phenyl]-N'-(2-ethyl-4-hydroxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 167079388 |
| Molecular Formula | C30H37N7O2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | 4-[(3-amino-2,2-dimethylcyclopentyl)amino]-6-[3-amino-5-(hydroxymethyl)phenyl]-N'-(2-ethyl-4-hydroxyphenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O)ccc1/N=C(\N)c1cnn2cc(-c3cc(N)cc(CO)c3)cc2c1NC1CCC(N)C1(C)C |
| InChI | InChI=1S/C30H37N7O2/c1-4-18-12-22(39)5-6-24(18)35-29(33)23-14-34-37-15-20(19-9-17(16-38)10-21(31)11-19)13-25(37)28(23)36-27-8-7-26(32)30(27,2)3/h5-6,9-15,26-27,36,38-39H,4,7-8,16,31-32H2,1-3H3,(H2,33,35) |
| InChIKey | XDVNKGLFCPIMBP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 160.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|