C31H43BrN6O2Si — CID 163375958
6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-4-[[(2S)-1-(cyclopropanecarbonyl)pyrrolidin-2-yl]methylamino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375958) has the molecular formula C31H43BrN6O2Si and a molecular weight of 639.72 g/mol. Its IUPAC name is 6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-4-[[(2S)-1-(cyclopropanecarbonyl)pyrrolidin-2-yl]methylamino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-4-[[(2S)-1-(cyclopropanecarbonyl)pyrrolidin-2-yl]methylamino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375958 |
| Molecular Formula | C31H43BrN6O2Si |
| Molecular Weight | 639.72 g/mol |
| Exact Mass | 638.24 |
| IUPAC Name | 6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-4-[[(2S)-1-(cyclopropanecarbonyl)pyrrolidin-2-yl]methylamino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O[Si](C)(C)C(C)(C)C)ccc1/N=C(\N)c1cnn2cc(Br)cc2c1NC[C@@H]1CCCN1C(=O)C1CC1 |
| InChI | InChI=1S/C31H43BrN6O2Si/c1-7-20-15-24(40-41(5,6)31(2,3)4)12-13-26(20)36-29(33)25-18-35-38-19-22(32)16-27(38)28(25)34-17-23-9-8-14-37(23)30(39)21-10-11-21/h12-13,15-16,18-19,21,23,34H,7-11,14,17H2,1-6H3,(H2,33,36)/t23-/m0/s1 |
| InChIKey | HRQMUXSMHWKRDL-QHCPKHFHSA-N |
| XLogP | 6.89 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.72 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|