C26H30BrClFN7 — CID 163375478
6-bromo-N'-(2-chloro-5-fluorophenyl)-4-[[7-(cyanomethyl)-2-ethyl-1-azabicyclo[4.1.0]heptan-4-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide;ethane (PubChem CID 163375478) has the molecular formula C26H30BrClFN7 and a molecular weight of 574.93 g/mol. Its IUPAC name is 6-bromo-N'-(2-chloro-5-fluorophenyl)-4-[[7-(cyanomethyl)-2-ethyl-1-azabicyclo[4.1.0]heptan-4-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide;ethane.
| Compound Name | 6-bromo-N'-(2-chloro-5-fluorophenyl)-4-[[7-(cyanomethyl)-2-ethyl-1-azabicyclo[4.1.0]heptan-4-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide;ethane |
|---|---|
| PubChem CID | 163375478 |
| Molecular Formula | C26H30BrClFN7 |
| Molecular Weight | 574.93 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | 6-bromo-N'-(2-chloro-5-fluorophenyl)-4-[[7-(cyanomethyl)-2-ethyl-1-azabicyclo[4.1.0]heptan-4-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide;ethane |
| SMILES | CC.CCC1CC(Nc2c(/C(N)=N\c3cc(F)ccc3Cl)cnn3cc(Br)cc23)CC2C(CC#N)N12 |
| InChI | InChI=1S/C24H24BrClFN7.C2H6/c1-2-16-9-15(10-21-20(5-6-28)34(16)21)31-23-17(11-30-33-12-13(25)7-22(23)33)24(29)32-19-8-14(27)3-4-18(19)26;1-2/h3-4,7-8,11-12,15-16,20-21,31H,2,5,9-10H2,1H3,(H2,29,32);1-2H3 |
| InChIKey | GGJNVFMKRVCYPP-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 94.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.93 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|