C14H8BrCl2FN4 — CID 163375481
6-bromo-4-chloro-N'-(2-chloro-5-fluorophenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375481) has the molecular formula C14H8BrCl2FN4 and a molecular weight of 402.05 g/mol. Its IUPAC name is 6-bromo-4-chloro-N'-(2-chloro-5-fluorophenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 6-bromo-4-chloro-N'-(2-chloro-5-fluorophenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375481 |
| Molecular Formula | C14H8BrCl2FN4 |
| Molecular Weight | 402.05 g/mol |
| Exact Mass | 399.93 |
| IUPAC Name | 6-bromo-4-chloro-N'-(2-chloro-5-fluorophenyl)pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | N/C(=N\c1cc(F)ccc1Cl)c1cnn2cc(Br)cc2c1Cl |
| InChI | InChI=1S/C14H8BrCl2FN4/c15-7-3-12-13(17)9(5-20-22(12)6-7)14(19)21-11-4-8(18)1-2-10(11)16/h1-6H,(H2,19,21) |
| InChIKey | UEBXNWQGFIVBKS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.05 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|