C22H27BrClFN4 — CID 163376093
6-bromo-3-[(2-chloro-5-fluorophenyl)iminomethyl]pyrrolo[1,2-b]pyridazin-4-amine;cyclohexane;ethane (PubChem CID 163376093) has the molecular formula C22H27BrClFN4 and a molecular weight of 481.84 g/mol. Its IUPAC name is 6-bromo-3-[(2-chloro-5-fluorophenyl)iminomethyl]pyrrolo[1,2-b]pyridazin-4-amine;cyclohexane;ethane.
| Compound Name | 6-bromo-3-[(2-chloro-5-fluorophenyl)iminomethyl]pyrrolo[1,2-b]pyridazin-4-amine;cyclohexane;ethane |
|---|---|
| PubChem CID | 163376093 |
| Molecular Formula | C22H27BrClFN4 |
| Molecular Weight | 481.84 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 6-bromo-3-[(2-chloro-5-fluorophenyl)iminomethyl]pyrrolo[1,2-b]pyridazin-4-amine;cyclohexane;ethane |
| SMILES | C1CCCCC1.CC.Nc1c(/C=N/c2cc(F)ccc2Cl)cnn2cc(Br)cc12 |
| InChI | InChI=1S/C14H9BrClFN4.C6H12.C2H6/c15-9-3-13-14(18)8(6-20-21(13)7-9)5-19-12-4-10(17)1-2-11(12)16;1-2-4-6-5-3-1;1-2/h1-7H,18H2;1-6H2;1-2H3/b19-5+;; |
| InChIKey | FUVOZPRMXRFSHW-NGONDPLUSA-N |
| XLogP | 7.59 |
| TPSA | 55.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.84 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|