C27H34BrFN6O2 — CID 163375828
tert-butyl N-[4-[[6-bromo-3-[N'-(2-ethyl-5-fluorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-4-yl]amino]cyclohexyl]carbamate (PubChem CID 163375828) has the molecular formula C27H34BrFN6O2 and a molecular weight of 573.51 g/mol. Its IUPAC name is tert-butyl N-[4-[[6-bromo-3-[N'-(2-ethyl-5-fluorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-4-yl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[6-bromo-3-[N'-(2-ethyl-5-fluorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-4-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 163375828 |
| Molecular Formula | C27H34BrFN6O2 |
| Molecular Weight | 573.51 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | tert-butyl N-[4-[[6-bromo-3-[N'-(2-ethyl-5-fluorophenyl)carbamimidoyl]pyrrolo[1,2-b]pyridazin-4-yl]amino]cyclohexyl]carbamate |
| SMILES | CCc1ccc(F)cc1/N=C(/N)c1cnn2cc(Br)cc2c1NC1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C27H34BrFN6O2/c1-5-16-6-7-18(29)13-22(16)34-25(30)21-14-31-35-15-17(28)12-23(35)24(21)32-19-8-10-20(11-9-19)33-26(36)37-27(2,3)4/h6-7,12-15,19-20,32H,5,8-11H2,1-4H3,(H2,30,34)(H,33,36) |
| InChIKey | QDXRAVQRHJAWNB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 106.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|