C35H44F3N5OSi — CID 163376002
N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-6-phenyl-4-[[2-(trifluoromethyl)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163376002) has the molecular formula C35H44F3N5OSi and a molecular weight of 635.85 g/mol. Its IUPAC name is N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-6-phenyl-4-[[2-(trifluoromethyl)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-6-phenyl-4-[[2-(trifluoromethyl)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163376002 |
| Molecular Formula | C35H44F3N5OSi |
| Molecular Weight | 635.85 g/mol |
| Exact Mass | 635.33 |
| IUPAC Name | N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethylphenyl]-6-phenyl-4-[[2-(trifluoromethyl)cyclohexyl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O[Si](C)(C)C(C)(C)C)ccc1/N=C(\N)c1cnn2cc(-c3ccccc3)cc2c1NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C35H44F3N5OSi/c1-7-23-19-26(44-45(5,6)34(2,3)4)17-18-29(23)42-33(39)27-21-40-43-22-25(24-13-9-8-10-14-24)20-31(43)32(27)41-30-16-12-11-15-28(30)35(36,37)38/h8-10,13-14,17-22,28,30,41H,7,11-12,15-16H2,1-6H3,(H2,39,42) |
| InChIKey | RKWPFXUSPYNBBR-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 76.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.85 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|