C30H42BrF3N6OSi — CID 163375015
4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)phenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375015) has the molecular formula C30H42BrF3N6OSi and a molecular weight of 667.69 g/mol. Its IUPAC name is 4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)phenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)phenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375015 |
| Molecular Formula | C30H42BrF3N6OSi |
| Molecular Weight | 667.69 g/mol |
| Exact Mass | 666.23 |
| IUPAC Name | 4-[[(1R,3S)-3-amino-2,2,3-trimethylcyclopentyl]amino]-6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-(2,2,2-trifluoroethyl)phenyl]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CC1(C)[C@H](Nc2c(/C(N)=N/c3ccc(O[Si](C)(C)C(C)(C)C)cc3CC(F)(F)F)cnn3cc(Br)cc23)CC[C@]1(C)N |
| InChI | InChI=1S/C30H42BrF3N6OSi/c1-27(2,3)42(7,8)41-20-9-10-22(18(13-20)15-30(32,33)34)38-26(35)21-16-37-40-17-19(31)14-23(40)25(21)39-24-11-12-29(6,36)28(24,4)5/h9-10,13-14,16-17,24,39H,11-12,15,36H2,1-8H3,(H2,35,38)/t24-,29+/m1/s1 |
| InChIKey | RGVQEBMGQULGFS-GIGWZHCTSA-N |
| XLogP | 7.94 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.69 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|