C26H35BrFN5O2Si — CID 163375233
6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-fluorophenyl]-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide (PubChem CID 163375233) has the molecular formula C26H35BrFN5O2Si and a molecular weight of 576.59 g/mol. Its IUPAC name is 6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-fluorophenyl]-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide.
| Compound Name | 6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-fluorophenyl]-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
|---|---|
| PubChem CID | 163375233 |
| Molecular Formula | C26H35BrFN5O2Si |
| Molecular Weight | 576.59 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | 6-bromo-N'-[4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-5-fluorophenyl]-4-[[(3S)-oxolan-3-yl]amino]pyrrolo[1,2-b]pyridazine-3-carboximidamide |
| SMILES | CCc1cc(O[Si](C)(C)C(C)(C)C)c(F)cc1/N=C(\N)c1cnn2cc(Br)cc2c1N[C@H]1CCOC1 |
| InChI | InChI=1S/C26H35BrFN5O2Si/c1-7-16-10-23(35-36(5,6)26(2,3)4)20(28)12-21(16)32-25(29)19-13-30-33-14-17(27)11-22(33)24(19)31-18-8-9-34-15-18/h10-14,18,31H,7-9,15H2,1-6H3,(H2,29,32)/t18-/m0/s1 |
| InChIKey | XGWILVUDXYTBAW-SFHVURJKSA-N |
| XLogP | 6.42 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|