C21H28BrN5O3 — CID 122692003
tert-butyl (4R,5R)-5-[(6-bromo-3-carbamoylpyrrolo[1,2-b]pyridazin-4-yl)amino]-4-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 122692003) has the molecular formula C21H28BrN5O3 and a molecular weight of 478.39 g/mol. Its IUPAC name is tert-butyl (4R,5R)-5-[(6-bromo-3-carbamoylpyrrolo[1,2-b]pyridazin-4-yl)amino]-4-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (4R,5R)-5-[(6-bromo-3-carbamoylpyrrolo[1,2-b]pyridazin-4-yl)amino]-4-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 122692003 |
| Molecular Formula | C21H28BrN5O3 |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | tert-butyl (4R,5R)-5-[(6-bromo-3-carbamoylpyrrolo[1,2-b]pyridazin-4-yl)amino]-4-methyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | C[C@@H]1C2CN(C(=O)OC(C)(C)C)CC2C[C@H]1Nc1c(C(N)=O)cnn2cc(Br)cc12 |
| InChI | InChI=1S/C21H28BrN5O3/c1-11-15-10-26(20(29)30-21(2,3)4)8-12(15)5-16(11)25-18-14(19(23)28)7-24-27-9-13(22)6-17(18)27/h6-7,9,11-12,15-16,25H,5,8,10H2,1-4H3,(H2,23,28)/t11-,12?,15?,16-/m1/s1 |
| InChIKey | KOPYLJHVKFIOHR-NKYJIASMSA-N |
| XLogP | 3.50 |
| TPSA | 101.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |