C16H23BrN4O4S — CID 66820795
tert-butyl 5-[(2-amino-5-bromo-3-pyridinyl)sulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxylate (PubChem CID 66820795) has the molecular formula C16H23BrN4O4S and a molecular weight of 447.36 g/mol. Its IUPAC name is tert-butyl 5-[(2-amino-5-bromo-3-pyridinyl)sulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl 5-[(2-amino-5-bromo-3-pyridinyl)sulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 66820795 |
| Molecular Formula | C16H23BrN4O4S |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | tert-butyl 5-[(2-amino-5-bromo-3-pyridinyl)sulfonyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CN(S(=O)(=O)c3cc(Br)cnc3N)CC2C1 |
| InChI | InChI=1S/C16H23BrN4O4S/c1-16(2,3)25-15(22)20-6-10-8-21(9-11(10)7-20)26(23,24)13-4-12(17)5-19-14(13)18/h4-5,10-11H,6-9H2,1-3H3,(H2,18,19) |
| InChIKey | GUNLCUJUDRDLCN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |