C8H12BrN — CID 163374939
4-bromo-3-ethylcyclohexa-1,3-dien-1-amine (PubChem CID 163374939) has the molecular formula C8H12BrN and a molecular weight of 202.09 g/mol. Its IUPAC name is 4-bromo-3-ethylcyclohexa-1,3-dien-1-amine.
| Compound Name | 4-bromo-3-ethylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163374939 |
| Molecular Formula | C8H12BrN |
| Molecular Weight | 202.09 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 4-bromo-3-ethylcyclohexa-1,3-dien-1-amine |
| SMILES | CCC1=C(Br)CCC(N)=C1 |
| InChI | InChI=1S/C8H12BrN/c1-2-6-5-7(10)3-4-8(6)9/h5H,2-4,10H2,1H3 |
| InChIKey | RSZUDCDRNTWXNX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.09 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |